4,6-Cholestadiene

• CAS: 27425-93-0
• Catalog Number: ACM27425930
• Category: Steroidal Compounds
• Molecular Weight: 368.44
• Molecular Formula: C₂₇H₄₄

Custom Q&A

What is the PubChem CID of 4,6-Cholestadiene?

PubChem CID of 4,6-Cholestadiene is 14187323.

What is the molecular formula of 4,6-Cholestadiene?

The molecular formula of 4,6-Cholestadiene is C27H44.

What is the molecular weight of 4,6-Cholestadiene?

The molecular weight of 4,6-Cholestadiene is 368.6 g/mol.

What is the IUPAC name of 4,6-Cholestadiene?

The IUPAC name of 4,6-Cholestadiene is (8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.

What is the InChI of 4,6-Cholestadiene?

The InChI of 4,6-Cholestadiene is InChI=1S/C27H44/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5/h11-13,19-20,22-25H,6-10,14-18H2,1-5H3/t20-,22+,23-,24+,25+,26+,27-/m1/s1.

What is the InChIKey of 4,6-Cholestadiene?

The InChIKey of 4,6-Cholestadiene is SSOCUFRKNVQUCP-HKQCOZBKSA-N.

What is the canonical SMILES of 4,6-Cholestadiene?

The canonical SMILES of 4,6-Cholestadiene is CC(C)CCCC(C)C1CCC2C1(CCC3C2C=CC4=CCCCC34C)C.

What is the isomeric SMILES of 4,6-Cholestadiene?

The isomeric SMILES of 4,6-Cholestadiene is C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=CC4=CCCC[C@]34C)C.

What is the XLogP3-AA value of 4,6-Cholestadiene?

The XLogP3-AA value of 4,6-Cholestadiene is 9.9.

What is the hydrogen bond donor count of 4,6-Cholestadiene?

The hydrogen bond donor count of 4,6-Cholestadiene is 0.