CAS
52834-08-9 Purity
---
52834-08-9 Purity
---
Inquiry Basket
(4-(5-Bromopyrimidin-2-yloxy)phenyl)methanol
CAS
1189734-03-9
Catalog Number
ACM1189734039
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C11H9BrN2O2.
What is the molecular weight of the compound?
The molecular weight of the compound is 281.10 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [4-(5-bromopyrimidin-2-yl)oxyphenyl]methanol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H9BrN2O2/c12-9-5-13-11(14-6-9)16-10-3-1-8(7-15)2-4-10/h1-6,15H,7H2.
What is the InChIKey of the compound?
The InChIKey of the compound is XWZWLZHGGKKQPU-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC=C1CO)OC2=NC=C(C=N2)Br.
What is the CAS number of the compound?
The CAS number of the compound is 1189734-03-9.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 1.9.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
Recommended Products
![5-Bromo-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine](https://resource.alfa-chemistry.com/structure/115170-40-6.gif)
