121669-70-3 Purity
95%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C12H15BO3.
The molecular weight of the compound is 218.06 g/mol.
The IUPAC name of the compound is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)benzaldehyde.
The InChI of the compound is InChI=1S/C12H15BO3/c1-12(2)8-15-13(16-9-12)11-5-3-10(7-14)4-6-11/h3-7H,8-9H2,1-2H3.
The InChIKey of the compound is JUHDMCQVJGHKFW-UHFFFAOYSA-N.
The canonical SMILES of the compound is B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C=O.
The CAS number of the compound is 128376-65-8.
The European Community (EC) number of the compound is 805-034-7.
The DSSTox Substance ID of the compound is DTXSID90400696.
Yes, the compound is canonicalized.