4,4-Methylenebis(2,6-diethylaniline)

• CAS: 13680-35-8
• Catalog Number: ACM13680358
• Category: Polymer/Macromolecule
• Molecular Weight: 310.48
• Molecular Formula: C₂₁H₃₀N₂
• Synonyms: 4,4-METHYLENEBIS(2,6-DIETHYLANILINE);LONZACURE(R) M-DEA;LABOTEST-BB LT00053356;4,4'-methylenebis[2,6-diethyl-benzenamin;4,4'-methylenebis[2,6-diethyl-Benzenamine;4,4-Methylene-(Bis(2,6-Diethylaniline) (MDEA);4,4-METHYLENEBIS(2,6-DIETHYLANILINE), 9 9%;Benz

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C21H30N2.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline.

What is the InChIKey of the compound?

The InChIKey of the compound is NWIVYGKSHSJHEF-UHFFFAOYSA-N.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation of the compound is CCC1=CC(=CC(=C1N)CC)CC2=CC(=C(C(=C2)CC)N)CC.

What is the molecular weight of the compound?

The molecular weight of the compound is 310.5 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 52Ų.

How many rotatable bond counts does the compound have?

The compound has 6 rotatable bond counts.

What is the primary synonym of the compound?

The primary synonym of the compound is 4,4'-Methylenebis(2,6-diethylaniline).