123843-65-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 4-(4-Fluorophenoxy)benzaldehyde is C13H9FO2.
The molecular weight of 4-(4-Fluorophenoxy)benzaldehyde is 216.21 g/mol.
The IUPAC name of 4-(4-Fluorophenoxy)benzaldehyde is 4-(4-fluorophenoxy)benzaldehyde.
The InChIKey of 4-(4-Fluorophenoxy)benzaldehyde is YUPBWHURNLRZQL-UHFFFAOYSA-N.
The Canonical SMILES of 4-(4-Fluorophenoxy)benzaldehyde is C1=CC(=CC=C1C=O)OC2=CC=C(C=C2)F.
The CAS number of 4-(4-Fluorophenoxy)benzaldehyde is 137736-06-2.
The XLogP3-AA value of 4-(4-Fluorophenoxy)benzaldehyde is 3.
4-(4-Fluorophenoxy)benzaldehyde has 3 hydrogen bond acceptor counts.
The topological polar surface area of 4-(4-Fluorophenoxy)benzaldehyde is 26.3 Ų.
Yes, 4-(4-Fluorophenoxy)benzaldehyde is considered as a canonical compound.