4-(4-Bromophenyl)piperidine-4-carboxylic acid

• CAS: 913542-80-0
• Catalog Number: ACM913542800
• Category: Other Products
• Molecular Weight: 284.152
• Molecular Formula: C₁₂H₁₄BrNO₂
• Synonyms: 4-(4-BROMOPHENYL)PIPERIDINE-4-CARBOXYLIC ACID
• Density: 1.468

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C12H14BrNO2.

What is the molecular weight of the compound?

The molecular weight of the compound is 284.15 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-(4-bromophenyl)piperidine-4-carboxylic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H14BrNO2/c13-10-3-1-9(2-4-10)12(11(15)16)5-7-14-8-6-12/h1-4,14H,5-8H2,(H,15,16).

What is the InChIKey of the compound?

The InChIKey of the compound is NVDSELFOZXBDOZ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1CNCCC1(C2=CC=C(C=C2)Br)C(=O)O.

What is the CAS number of the compound?

The CAS number of the compound is 913542-80-0.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is -0.3.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 2.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 3.