129757-67-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 4-[4-[4-(4-aminophenoxy)phenyl]phenoxy]aniline.
The molecular formula of the compound is C24H20N2O2.
The molecular weight of the compound is 368.4 g/mol.
The InChI of the compound is InChI=1S/C24H20N2O2/c25-19-5-13-23(14-6-19)27-21-9-1-17(2-10-21)18-3-11-22(12-4-18)28-24-15-7-20(26)8-16-24/h1-16H,25-26H2.
The InChIKey of the compound is HYDATEKARGDBKU-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC=C1C2=CC=C(C=C2)OC3=CC=C(C=C3)N)OC4=CC=C(C=C4)N.
The CAS number of the compound is 13080-85-8.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.
The XLogP3 value of the compound is 4.4.