4-(2-Thienyl)benzoic acid

• CAS: 29886-62-2
• Catalog Number: ACM29886622
• Category: Boronic Acids
• Molecular Weight: 204.245
• Molecular Formula: C₁₁H₈O₂S

Custom Q&A

What is the molecular formula of 4-(2-Thienyl)benzoic acid?

The molecular formula is C11H8O2S.

What is the molecular weight of 4-(2-Thienyl)benzoic acid?

The molecular weight is 204.25 g/mol.

What are the synonyms of 4-(2-Thienyl)benzoic acid?

The synonyms are 4-(Thiophen-2-yl)benzoic acid, 29886-62-2, 4-thiophen-2-yl-benzoic acid, and 4-Thiophen-2-ylbenzoic acid.

What is the IUPAC name of 4-(2-Thienyl)benzoic acid?

The IUPAC name is 4-thiophen-2-ylbenzoic acid.

What is the InChI of 4-(2-Thienyl)benzoic acid?

The InChI is InChI=1S/C11H8O2S/c12-11(13)9-5-3-8(4-6-9)10-2-1-7-14-10/h1-7H,(H,12,13).

What is the InChIKey of 4-(2-Thienyl)benzoic acid?

The InChIKey is CVDUBQJEQNRCIZ-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(2-Thienyl)benzoic acid?

The canonical SMILES is C1=CSC(=C1)C2=CC=C(C=C2)C(=O)O.

What is the CAS number of 4-(2-Thienyl)benzoic acid?

The CAS number is 300816-11-9.

What is the XLogP3 value of 4-(2-Thienyl)benzoic acid?

The XLogP3 value is 3.3.

Is 4-(2-Thienyl)benzoic acid a canonicalized compound?

Yes, it is a canonicalized compound.