4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid

• Catalog Number: ACMA00002267
• Category: Ethers
• Molecular Weight: 238.24
• Molecular Formula: C₁₂H₁₄O₄
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The molecular formula is C12H14O5.

What is the molecular weight of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The molecular weight is 238.24 g/mol.

What is the IUPAC name of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The IUPAC name is 4-(2,3-dimethoxyphenyl)-4-oxobutanoic acid.

What is the InChI of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The InChI is InChI=1S/C12H14O5/c1-16-10-5-3-4-8(12(10)17-2)9(13)6-7-11(14)15/h3-5H,6-7H2,1-2H3,(H,14,15).

What is the InChIKey of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The InChIKey is QUWHEXSRYUEKHA-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The canonical SMILES is COC1=CC=CC(=C1OC)C(=O)CCC(=O)O.

What is the CAS number of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The CAS number is 898792-27-3.

What is the XLogP3-AA value of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The XLogP3-AA value is 1.

What is the hydrogen bond donor count of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 4-(2,3-Dimethoxyphenyl)-4-oxobutyric acid?

The hydrogen bond acceptor count is 5.