4-(1-Methylethyl)benzenesulfonyl fluoride

CAS

4365-11-1

Catalog Number

ACM4365111

Category

Alkynes

Molecular Weight

202.25

Molecular Formula

C₇H₁₀

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Hazard Statements

H225

RIDADR

UN 3261 8 / PGII

Symbol

GHS02

What is the PubChem CID for 4-(1-Methylethyl)benzenesulfonyl fluoride?

The PubChem CID for 4-(1-Methylethyl)benzenesulfonyl fluoride is 71363101.

What is the molecular formula of 4-(1-Methylethyl)benzenesulfonyl fluoride?

The molecular formula of 4-(1-Methylethyl)benzenesulfonyl fluoride is C9H11FO2S.

What are the synonyms for 4-(1-Methylethyl)benzenesulfonyl fluoride?

The synonyms for 4-(1-Methylethyl)benzenesulfonyl fluoride include 4-(Propan-2-yl)benzene-1-sulfonyl fluoride, 4365-11-1, 4-propan-2-ylbenzenesulfonyl fluoride, SCHEMBL24810807, DTXSID30786683, and more.

What is the molecular weight of 4-(1-Methylethyl)benzenesulfonyl fluoride?

The molecular weight of 4-(1-Methylethyl)benzenesulfonyl fluoride is 202.25 g/mol.

What is the IUPAC name of 4-(1-Methylethyl)benzenesulfonyl fluoride?

The IUPAC name of 4-(1-Methylethyl)benzenesulfonyl fluoride is 4-propan-2-ylbenzenesulfonyl fluoride.

What is the InChI of 4-(1-Methylethyl)benzenesulfonyl fluoride?

The InChI of 4-(1-Methylethyl)benzenesulfonyl fluoride is InChI=1S/C9H11FO2S/c1-7(2)8-3-5-9(6-4-8)13(10,11)12/h3-7H,1-2H3.

What is the InChIKey of 4-(1-Methylethyl)benzenesulfonyl fluoride?

The InChIKey of 4-(1-Methylethyl)benzenesulfonyl fluoride is OAEGHLYWVJNQGT-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-(1-Methylethyl)benzenesulfonyl fluoride?

The Canonical SMILES of 4-(1-Methylethyl)benzenesulfonyl fluoride is CC(C)C1=CC=C(C=C1)S(=O)(=O)F.

What is the CAS number of 4-(1-Methylethyl)benzenesulfonyl fluoride?

The CAS number of 4-(1-Methylethyl)benzenesulfonyl fluoride is 4365-11-1.

What is the molecular weight, XLogP3, hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoisotopic mass, topological polar surface area, heavy atom count, formal charge, complexity, isotope atom count, defined atom stereocenter count, undefined atom stereocenter count, defined bond stereocenter count, undefined bond stereocenter count, covalently-bonded unit count, and whether the compound is canonicalized for 4-(1-Methylethyl)benzenesulfonyl fluoride?

The molecular weight is 202.25 g/mol.
The XLogP3 is 3.
The hydrogen bond donor count is 0.
The hydrogen bond acceptor count is 3.
The rotatable bond count is 2.
The exact mass is 202.04637893 g/mol.
The monoisotopic mass is 202.04637893 g/mol.
The topological polar surface area is 42.5Å².
The heavy atom count is 13.
The formal charge is 0.
The complexity is 245.
The isotope atom count is 0.
The defined atom stereocenter count is 0.
The undefined atom stereocenter count is 0.
The defined bond stereocenter count is 0.
The undefined bond stereocenter count is 0.
The covalently-bonded unit count is 1.
The compound is canonicalized.