--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H13NO4S.
The synonyms of the compound include 22230-37-1, 4-(1,1-Dioxo-1lambda*6*-[1,2]thiazinan-2-yl)-benzoic acid, 4-(1,1-dioxothiazinan-2-yl)benzoic acid, and MLS000716481.
The molecular weight of the compound is 255.29 g/mol.
The IUPAC name of the compound is 4-(1,1-dioxothiazinan-2-yl)benzoic acid.
The InChI of the compound is InChI=1S/C11H13NO4S/c13-11(14)9-3-5-10(6-4-9)12-7-1-2-8-17(12,15)16/h3-6H,1-2,7-8H2,(H,13,14).
The InChIKey of the compound is OVJPSCBTLLBKAU-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CCS(=O)(=O)N(C1)C2=CC=C(C=C2)C(=O)O.
The XLogP3-AA value of the compound is 1.1.
The compound has 1 hydrogen bond donor count.
The compound has 5 hydrogen bond acceptor counts.
[Other Products] Fluorphlogopite(Mg3K[AlF2O(SiO3)3]) Catalog: ACM12003382 CAS: 12003-38-2 |