3-Sulfamoyl-benzoic acid

• Catalog Number: ACMA00000690
• Category: Alkyl Fluorinated Building Blocks
• Molecular Weight: 201.20
• Molecular Formula: C₇H₁₂F₂O₂
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-Sulfamoyl-benzoic acid?

The molecular formula of 3-Sulfamoyl-benzoic acid is C7H7NO4S.

What is the molecular weight of 3-Sulfamoyl-benzoic acid?

The molecular weight of 3-Sulfamoyl-benzoic acid is 201.20 g/mol.

What is the IUPAC name of 3-Sulfamoyl-benzoic acid?

The IUPAC name of 3-Sulfamoyl-benzoic acid is 3-sulfamoylbenzoic acid.

What is the Canonical SMILES representation of 3-Sulfamoyl-benzoic acid?

The Canonical SMILES representation of 3-Sulfamoyl-benzoic acid is C1=CC(=CC(=C1)S(=O)(=O)N)C(=O)O.

What is the InChIKey of 3-Sulfamoyl-benzoic acid?

The InChIKey of 3-Sulfamoyl-benzoic acid is NAETXYOXMDYNLE-UHFFFAOYSA-N.

What is the CAS number of 3-Sulfamoyl-benzoic acid?

The CAS number of 3-Sulfamoyl-benzoic acid is 636-76-0.

How many hydrogen bond donor counts are there in 3-Sulfamoyl-benzoic acid?

There are 2 hydrogen bond donor counts in 3-Sulfamoyl-benzoic acid.

How many hydrogen bond acceptor counts are there in 3-Sulfamoyl-benzoic acid?

There are 5 hydrogen bond acceptor counts in 3-Sulfamoyl-benzoic acid.

What is the topological polar surface area of 3-Sulfamoyl-benzoic acid?

The topological polar surface area of 3-Sulfamoyl-benzoic acid is 106 Ų.

Is 3-Sulfamoyl-benzoic acid considered a canonicalized compound?

Yes, 3-Sulfamoyl-benzoic acid is considered a canonicalized compound.