3-Oxo-3,4-dihydro-2H-benzo[1,4]oxazine-6-carbaldehyde

• Catalog Number: ACMA00000866
• Category: Amines
• Molecular Weight: 177.16
• Molecular Formula: C₁₀H₁₃ClN₂O
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H7NO3.

What is the molecular weight of the compound?

The molecular weight of the compound is 177.16 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-oxo-4H-1,4-benzoxazine-6-carbaldehyde.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H7NO3/c11-4-6-1-2-8-7(3-6)10-9(12)5-13-8/h1-4H,5H2,(H,10,12).

What is the InChIKey of the compound?

The InChIKey of the compound is VHKABBARGFUYOF-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1C(=O)NC2=C(O1)C=CC(=C2)C=O.

What is the CAS number of the compound?

The CAS number of the compound is 200195-15-9.

What is the EC number of the compound?

The EC number of the compound is 676-114-5.

What is the ChEMBL ID of the compound?

The ChEMBL ID of the compound is CHEMBL2407100.

Is the compound canonicalized?

Yes, the compound is canonicalized.