3-Nitrobenzyl bromide

• CAS: 3958-57-4
• Catalog Number: ACM3958574
• Category: Bromine Series
• Molecular Weight: 216.03
• Molecular Formula: C₇H₆NO₂Br

Custom Q&A

What is the PubChem CID of 3-Nitrobenzyl bromide?

PubChem CID 77568

What is the molecular formula of 3-Nitrobenzyl bromide?

The molecular formula is C7H6BrNO2.

What are the synonyms of 3-Nitrobenzyl bromide?

The synonyms are 1-(Bromomethyl)-3-nitrobenzene and m-Nitrobenzyl bromide.

What is the molecular weight of 3-Nitrobenzyl bromide?

The molecular weight is 216.03 g/mol.

What is the IUPAC name of 3-Nitrobenzyl bromide?

The IUPAC name is 1-(bromomethyl)-3-nitrobenzene.

What is the InChI of 3-Nitrobenzyl bromide?

The InChI is InChI=1S/C7H6BrNO2/c8-5-6-2-1-3-7(4-6)9(10)11/h1-4H,5H2.

What is the InChIKey of 3-Nitrobenzyl bromide?

The InChIKey is LNWXALCHPJANMJ-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Nitrobenzyl bromide?

The canonical SMILES is C1=CC(=CC(=C1)[N+](=O)[O-])CBr.

What is the CAS number of 3-Nitrobenzyl bromide?

The CAS number is 3958-57-4.

Is 3-Nitrobenzyl bromide a canonicalized compound?

Yes, 3-Nitrobenzyl bromide is a canonicalized compound.