3-Nitro-4-carboxyphenylboronic acid

• CAS: 80500-28-3
• Catalog Number: ACM80500283
• Category: Boronic Acids

Custom Q&A

What is the PubChem CID for 3-Nitro-4-carboxyphenylboronic acid?

PubChem CID 329047

What is the molecular formula of 3-Nitro-4-carboxyphenylboronic acid?

The molecular formula is C7H6BNO6.

What are some synonyms for 3-Nitro-4-carboxyphenylboronic acid?

Some synonyms include 4-borono-2-nitrobenzoic acid, 80500-28-3, and 4-(dihydroxyboryl)-2-nitrobenzoic acid.

What is the molecular weight of 3-Nitro-4-carboxyphenylboronic acid?

The molecular weight is 210.94 g/mol.

What is the IUPAC name of 3-Nitro-4-carboxyphenylboronic acid?

The IUPAC name is 4-borono-2-nitrobenzoic acid.

What is the InChI of 3-Nitro-4-carboxyphenylboronic acid?

The InChI is InChI=1S/C7H6BNO6/c10-7(11)5-2-1-4(8(12)13)3-6(5)9(14)15/h1-3,12-13H,(H,10,11).

What is the Canonical SMILES of 3-Nitro-4-carboxyphenylboronic acid?

The Canonical SMILES is B(C1=CC(=C(C=C1)C(=O)O)[N+](=O)[O-])(O)O.

What is the CAS number of 3-Nitro-4-carboxyphenylboronic acid?

The CAS number is 80500-28-3.

What is the EC number of 3-Nitro-4-carboxyphenylboronic acid?

The EC number is 833-800-0.

What is the molecular weight, hydrogen bond donor count, and hydrogen bond acceptor count of 3-Nitro-4-carboxyphenylboronic acid?

The molecular weight is 210.94 g/mol, the hydrogen bond donor count is 3, and the hydrogen bond acceptor count is 6.