3-Methoxy-5-methylphenylboronic acid

• CAS: 725251-81-0
• Catalog Number: ACM725251810-1
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 3-Methoxy-5-methylphenylboronic acid?

The molecular formula is C8H11BO3.

What are the synonyms of 3-Methoxy-5-methylphenylboronic acid?

The synonyms include (3-Methoxy-5-methylphenyl)boronic acid, 3-METHOXY-5-METHYLPHENYLBORONIC ACID, Boronic acid, (3-methoxy-5-methylphenyl)-.

What is the molecular weight of 3-Methoxy-5-methylphenylboronic acid?

The molecular weight is 165.98 g/mol.

What is the IUPAC name of 3-Methoxy-5-methylphenylboronic acid?

The IUPAC name is (3-methoxy-5-methylphenyl)boronic acid.

What is the InChI of 3-Methoxy-5-methylphenylboronic acid?

The InChI is InChI=1S/C8H11BO3/c1-6-3-7(9(10)11)5-8(4-6)12-2/h3-5,10-11H,1-2H3.

What is the InChIKey of 3-Methoxy-5-methylphenylboronic acid?

The InChIKey is DJBDBFHWWWCNER-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Methoxy-5-methylphenylboronic acid?

The canonical SMILES is B(C1=CC(=CC(=C1)OC)C)(O)O.

What is the CAS number of 3-Methoxy-5-methylphenylboronic acid?

The CAS number is 725251-81-0.

What is the hydrogen bond donor count of 3-Methoxy-5-methylphenylboronic acid?

The hydrogen bond donor count is 2.

Is 3-Methoxy-5-methylphenylboronic acid a canonicalized compound?

Yes, it is a canonicalized compound.