--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C11H10O3.
The molecular weight of the compound is 190.19 g/mol.
The IUPAC name of the compound is 3-methoxy-4-prop-2-ynoxybenzaldehyde.
The InChI of the compound is InChI=1S/C11H10O3/c1-3-6-14-10-5-4-9(8-12)7-11(10)13-2/h1,4-5,7-8H,6H2,2H3.
The InChIKey of the compound is PKPPALIWMCCRFK-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=C(C=CC(=C1)C=O)OCC#C.
The CAS number of the compound is 5651-83-2.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.