529-96-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 3-methoxy-2-nitrobenzaldehyde.
The molecular formula of the compound is C8H7NO4.
The molecular weight of the compound is 181.15 g/mol.
The InChI of the compound is InChI=1S/C8H7NO4/c1-13-7-4-2-3-6(5-10)8(7)9(11)12/h2-5H,1H3.
The InChIKey of the compound is GDTUACILWWLIJF-UHFFFAOYSA-N.
The Canonical SMILES of the compound is COC1=CC=CC(=C1[N+](=O)[O-])C=O.
The CAS number of the compound is 53055-05-3.
The European Community (EC) Number of the compound is 258-332-9.
The UNII of the compound is 4W88LZM8VP.
The XLogP3 value of the compound is 1.