3-Hydroxy-3-hydroxymethyloxetane

• CAS: 16563-93-2
• Catalog Number: ACM16563932
• Category: Other Products
• Molecular Weight: 104
• Molecular Formula: C₄H₈O₃
• Synonyms: 3-hydroxy-3-hydroxymethyloxetane;3-(hydroxymethyl)oxetan-3-ol

Custom Q&A

What is the molecular formula of 3-Hydroxy-3-hydroxymethyloxetane?

The molecular formula of 3-Hydroxy-3-hydroxymethyloxetane is C4H8O3.

What is the molecular weight of 3-Hydroxy-3-hydroxymethyloxetane?

The molecular weight of 3-Hydroxy-3-hydroxymethyloxetane is 104.10 g/mol.

What is the IUPAC name of 3-Hydroxy-3-hydroxymethyloxetane?

The IUPAC name of 3-Hydroxy-3-hydroxymethyloxetane is 3-(hydroxymethyl)oxetan-3-ol.

What is the InChI of 3-Hydroxy-3-hydroxymethyloxetane?

The InChI of 3-Hydroxy-3-hydroxymethyloxetane is InChI=1S/C4H8O3/c5-1-4(6)2-7-3-4/h5-6H,1-3H2.

What is the InChIKey of 3-Hydroxy-3-hydroxymethyloxetane?

The InChIKey of 3-Hydroxy-3-hydroxymethyloxetane is TVRBHJADIOFJDI-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Hydroxy-3-hydroxymethyloxetane?

The canonical SMILES of 3-Hydroxy-3-hydroxymethyloxetane is C1C(CO1)(CO)O.

What other identifiers does 3-Hydroxy-3-hydroxymethyloxetane have?

3-Hydroxy-3-hydroxymethyloxetane has the CAS identifier 16563-93-2, DSSTox Substance ID DTXSID00693532, and Wikidata Q82622585.

What is the XLogP3-AA value of 3-Hydroxy-3-hydroxymethyloxetane?

The XLogP3-AA value of 3-Hydroxy-3-hydroxymethyloxetane is -1.6.

How many hydrogen bond donor atoms are there in 3-Hydroxy-3-hydroxymethyloxetane?

There are 2 hydrogen bond donor atoms in 3-Hydroxy-3-hydroxymethyloxetane.

How many hydrogen bond acceptor atoms are there in 3-Hydroxy-3-hydroxymethyloxetane?

There are 3 hydrogen bond acceptor atoms in 3-Hydroxy-3-hydroxymethyloxetane.