3-[Dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate

• CAS: 3637-26-1
• Catalog Number: ACM3637261
• Category: Polymer/Macromolecule
• Molecular Weight: 279.35
• Molecular Formula: C₁₁H₂₁NO₅S
• Synonyms: SPE;N-(3-SULFOPROPYL)-N-METHACROYLOXYETHYL-N,N-DIMETHYL-AMMONIUM BETAINE;N-(3-SULFOPROPYL)-N-(METHACRYLOXYETHYL)-N,N-DIMETHYLAMMONIUM BETAINE;N-(2-METHACRYLOYLOXYETHYL)-N,N-DIMETHYL-N-(3-SULFOPROPYL)AMMONIUM BETAINE;N,N-DIMETHYL-N-(2-METHACRYLOLOXYETHYL)-

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C11H21NO5S.

What is the molecular weight of the compound?

The molecular weight of the compound is 279.36 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H21NO5S/c1-10(2)11(13)17-8-7-12(3,4)6-5-9-18(14,15)16/h1,5-9H2,2-4H3.

What is the InChIKey of the compound?

The InChIKey of the compound is BCAIDFOKQCVACE-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC(=C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-].

What is the CAS number of the compound?

The CAS number of the compound is 3637-26-1.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.3.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 91.9 Ų.