CAS
419536-33-7 Purity
---
419536-33-7 Purity
---
Inquiry Basket
3-Chloropyridin-4-boronic acid
CAS
458532-98-4
Catalog Number
ACM458532984
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Chloropyridin-4-boronic acid?
The molecular formula is C5H5BClNO2.
What is the molecular weight of 3-Chloropyridin-4-boronic acid?
The molecular weight is 157.36 g/mol.
What is the IUPAC name of 3-Chloropyridin-4-boronic acid?
The IUPAC name is (3-chloropyridin-4-yl)boronic acid.
What is the InChI of 3-Chloropyridin-4-boronic acid?
The InChI is InChI=1S/C5H5BClNO2/c7-5-3-8-2-1-4(5)6(9)10/h1-3,9-10H.
What is the InChIKey of 3-Chloropyridin-4-boronic acid?
The InChIKey is JLIHQPWLAOYTRH-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Chloropyridin-4-boronic acid?
The Canonical SMILES is B(C1=C(C=NC=C1)Cl)(O)O.
What is the CAS number of 3-Chloropyridin-4-boronic acid?
The CAS number is 458532-98-4.
How many hydrogen bond donor counts does 3-Chloropyridin-4-boronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Chloropyridin-4-boronic acid have?
It has 3 hydrogen bond acceptor counts.
What is the topological polar surface area of 3-Chloropyridin-4-boronic acid?
The topological polar surface area is 53.4Ų.
Recommended Products
