3-Chloro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one

• Catalog Number: ACMA00000595
• Category: Alkenyl
• Molecular Weight: 194.62
• Molecular Formula: C₈H₁₀ClN₃O₂
• Hazard Statements: H302
• RIDADR: UN 1993C 3 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular weight of 3-Chloro-2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one?

The molecular weight is 194.62 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-chloro-2-methylpyrido[1,2-a]pyrimidin-4-one.

What is the InChI of the compound?

The InChI is InChI=1S/C9H7ClN2O/c1-6-8(10)9(13)12-5-3-2-4-7(12)11-6/h2-5H,1H3.

What is the InChIKey of the compound?

The InChIKey is RFTUUEWMJJYMNE-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES is CC1=C(C(=O)N2C=CC=CC2=N1)Cl.

What is the XLogP3 value of the compound?

The XLogP3 value is 1.2.

How many hydrogen bond donor counts are there in the compound?

There are 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are there in the compound?

There are 2 hydrogen bond acceptor counts.

What is the exact mass of the compound?

The exact mass is 194.0246905 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.