3-Bromothiophene-4-boronic acid

• CAS: 101084-76-8
• Catalog Number: ACM101084768
• Category: Boronic Acids
• Molecular Weight: 206.85
• Molecular Formula: C₄H₄BBrO₂S

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C4H4BBrO2S.

What are the synonyms of the compound?

The synonyms of the compound are 101084-76-8, 3-Bromothiophene-4-boronic acid, (4-Bromothiophen-3-yl)boronic acid, 4-BROMOTHIOPHENE-3-BORONIC ACID, and Boronic acid, B-(4-bromo-3-thienyl)-.

What is the molecular weight of the compound?

The molecular weight of the compound is 206.86 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is (4-bromothiophen-3-yl)boronic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C4H4BBrO2S/c6-4-2-9-1-3(4)5(7)8/h1-2,7-8H.

What is the InChIKey of the compound?

The InChIKey of the compound is GGPJEVFFYNCPJV-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B(C1=CSC=C1Br)(O)O.

What is the CAS number of the compound?

The CAS number of the compound is 101084-76-8.

What is the European Community (EC) Number of the compound?

The European Community (EC) Number of the compound is 696-565-1.

What is the formal charge of the compound?

The formal charge of the compound is 0.