3-Bromobenzenesulfonamide

• CAS: 89599-01-9
• Catalog Number: ACM89599019
• Category: Bromine Series
• Molecular Weight: 236.09
• Molecular Formula: C₆H₆BrNO₂S

Custom Q&A

What is the molecular formula of 3-Bromobenzenesulfonamide?

The molecular formula is C6H6BrNO2S.

What is the molecular weight of 3-Bromobenzenesulfonamide?

The molecular weight is 236.09 g/mol.

What is the IUPAC name of 3-Bromobenzenesulfonamide?

The IUPAC name is 3-bromobenzenesulfonamide.

What is the InChI of 3-Bromobenzenesulfonamide?

The InChI is InChI=1S/C6H6BrNO2S/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H,(H2,8,9,10).

What is the InChIKey of 3-Bromobenzenesulfonamide?

The InChIKey is MUBJNMWVQGHHLG-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromobenzenesulfonamide?

The canonical SMILES is C1=CC(=CC(=C1)Br)S(=O)(=O)N.

What is the CAS number of 3-Bromobenzenesulfonamide?

The CAS number is 89599-01-9.

What is the EC number of 3-Bromobenzenesulfonamide?

The EC number is 677-280-1.

Is 3-Bromobenzenesulfonamide a covalently-bonded unit?

Yes, 3-Bromobenzenesulfonamide is a covalently-bonded unit.