CAS
1162257-58-0 Purity
---
1162257-58-0 Purity
---
Inquiry Basket
3-Bromo-6-Chloro-2-fluorophenylboronic acid
CAS
1451393-00-2
Catalog Number
ACM1451393002
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The molecular formula of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is C6H4BBrClFO2.
What are the synonyms for 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The synonyms for 3-Bromo-6-Chloro-2-fluorophenylboronic acid include 1451393-00-2, (3-Bromo-6-chloro-2-fluorophenyl)boronic acid, MFCD11044930, and BIC39300.
What is the molecular weight of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The molecular weight of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is 253.26 g/mol.
What is the IUPAC name of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The IUPAC name of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is (3-bromo-6-chloro-2-fluorophenyl)boronic acid.
What is the InChI of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The InChI of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is InChI=1S/C6H4BBrClFO2/c8-3-1-2-4(9)5(6(3)10)7(11)12/h1-2,11-12H.
What is the InChIKey of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The InChIKey of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is WMSQTXKBDIXIPN-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The canonical SMILES of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is B(C1=C(C=CC(=C1F)Br)Cl)(O)O.
What is the hydrogen bond donor count of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The hydrogen bond donor count of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is 2.
What is the hydrogen bond acceptor count of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The hydrogen bond acceptor count of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is 3.
What is the topological polar surface area of 3-Bromo-6-Chloro-2-fluorophenylboronic acid?
The topological polar surface area of 3-Bromo-6-Chloro-2-fluorophenylboronic acid is 40.5Ų.
Recommended Products
![Boronic acid, b-[2-[1-(triphenylmethyl)-1h-tetrazol-5-yl]phenyl]-](https://resource.alfa-chemistry.com/structure/144873-97-2.gif)
CAS
144873-97-2 Purity
96%
144873-97-2 Purity
96%
