3-Bromo-5-fluoropyridin-4-ol

• CAS: 1214342-60-5
• Catalog Number: ACM1214342605
• Category: Pyridines
• Molecular Weight: 192.0
• Molecular Formula: C5H3BrFNO
• Synonyms: 3-Bromo-5-fluoro-4-hydroxypyridine

Custom Q&A

What is the molecular formula of 3-Bromo-5-fluoropyridin-4-ol?

The molecular formula is C5H3BrFNO.

What is the IUPAC name of 3-Bromo-5-fluoropyridin-4-ol?

The IUPAC name is 3-bromo-5-fluoro-1H-pyridin-4-one.

What is the molecular weight of 3-Bromo-5-fluoropyridin-4-ol?

The molecular weight is 191.99 g/mol.

What is the InChI of 3-Bromo-5-fluoropyridin-4-ol?

The InChI is InChI=1S/C5H3BrFNO/c6-3-1-8-2-4(7)5(3)9/h1-2H,(H,8,9).

What is the InChIKey of 3-Bromo-5-fluoropyridin-4-ol?

The InChIKey is GNXBRKDCLLYOHE-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromo-5-fluoropyridin-4-ol?

The canonical SMILES is C1=C(C(=O)C(=CN1)Br)F.

What is the CAS number of 3-Bromo-5-fluoropyridin-4-ol?

The CAS number is 1214342-60-5.

What is the hydrogen bond donor count of 3-Bromo-5-fluoropyridin-4-ol?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 3-Bromo-5-fluoropyridin-4-ol?

The hydrogen bond acceptor count is 3.

Is 3-Bromo-5-fluoropyridin-4-ol a canonicalized compound?

Yes, 3-Bromo-5-fluoropyridin-4-ol is a canonicalized compound.