CAS
79544-27-7 Purity
98%+
79544-27-7 Purity
98%+
Inquiry Basket
3-Bromo-5-fluorobenzonitrile
CAS
179898-34-1
Catalog Number
ACM179898341
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-5-fluorobenzonitrile?
The molecular formula of 3-Bromo-5-fluorobenzonitrile is C7H3BrFN.
What is the molecular weight of 3-Bromo-5-fluorobenzonitrile?
The molecular weight of 3-Bromo-5-fluorobenzonitrile is 200.01 g/mol.
What is the IUPAC name of 3-Bromo-5-fluorobenzonitrile?
The IUPAC name of 3-Bromo-5-fluorobenzonitrile is 3-bromo-5-fluorobenzonitrile.
What is the InChI of 3-Bromo-5-fluorobenzonitrile?
The InChI of 3-Bromo-5-fluorobenzonitrile is InChI=1S/C7H3BrFN/c8-6-1-5(4-10)2-7(9)3-6/h1-3H.
What is the InChIKey of 3-Bromo-5-fluorobenzonitrile?
The InChIKey of 3-Bromo-5-fluorobenzonitrile is IADLVSLZPQYXIF-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-fluorobenzonitrile?
The canonical SMILES of 3-Bromo-5-fluorobenzonitrile is C1=C(C=C(C=C1F)Br)C#N.
What is the CAS number of 3-Bromo-5-fluorobenzonitrile?
The CAS number of 3-Bromo-5-fluorobenzonitrile is 179898-34-1.
What is the XLogP3-AA value of 3-Bromo-5-fluorobenzonitrile?
The XLogP3-AA value of 3-Bromo-5-fluorobenzonitrile is 2.4.
How many hydrogen bond donor counts does 3-Bromo-5-fluorobenzonitrile have?
3-Bromo-5-fluorobenzonitrile has 0 hydrogen bond donor counts.
Recommended Products
![3-Bromoimidazo[1,2-b]pyridazine](https://resource.alfa-chemistry.com/structure/18087-73-5.gif)
