CAS
130191-91-2 Purity
---
130191-91-2 Purity
---
Inquiry Basket
3-Bromo-5-chloro-2-hydroxybenzaldehyde
CAS
19652-32-5
Catalog Number
ACM19652325
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-5-chloro-2-hydroxybenzaldehyde?
The molecular formula of 3-Bromo-5-chloro-2-hydroxybenzaldehyde is C7H4BrClO2.
What is the molecular weight of 3-Bromo-5-chloro-2-hydroxybenzaldehyde?
The molecular weight of 3-Bromo-5-chloro-2-hydroxybenzaldehyde is 235.46 g/mol.
What is the IUPAC name of 3-Bromo-5-chloro-2-hydroxybenzaldehyde?
The IUPAC name of 3-Bromo-5-chloro-2-hydroxybenzaldehyde is 3-bromo-5-chloro-2-hydroxybenzaldehyde.
What is the InChI of 3-Bromo-5-chloro-2-hydroxybenzaldehyde?
The InChI of 3-Bromo-5-chloro-2-hydroxybenzaldehyde is InChI=1S/C7H4BrClO2/c8-6-2-5(9)1-4(3-10)7(6)11/h1-3,11H.
What is the InChIKey of 3-Bromo-5-chloro-2-hydroxybenzaldehyde?
The InChIKey of 3-Bromo-5-chloro-2-hydroxybenzaldehyde is KNOYZLVIXXBBIB-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-chloro-2-hydroxybenzaldehyde?
The canonical SMILES of 3-Bromo-5-chloro-2-hydroxybenzaldehyde is C1=C(C=C(C(=C1C=O)O)Br)Cl.
What is the CAS number of 3-Bromo-5-chloro-2-hydroxybenzaldehyde?
The CAS number of 3-Bromo-5-chloro-2-hydroxybenzaldehyde is 19652-32-5.
What is the XLogP3-AA value of 3-Bromo-5-chloro-2-hydroxybenzaldehyde?
The XLogP3-AA value of 3-Bromo-5-chloro-2-hydroxybenzaldehyde is 2.9.
How many hydrogen bond donor counts does 3-Bromo-5-chloro-2-hydroxybenzaldehyde have?
3-Bromo-5-chloro-2-hydroxybenzaldehyde has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Bromo-5-chloro-2-hydroxybenzaldehyde have?
3-Bromo-5-chloro-2-hydroxybenzaldehyde has 2 hydrogen bond acceptor counts.
Recommended Products
![2-(1H-benzo[d]imidazol-2-yl)-4-bromophenol](https://resource.alfa-chemistry.com/structure/62871-28-7.gif)
