3-Bromo-4-pyridineboronic acid

• CAS: 458532-99-5
• Catalog Number: ACM458532995
• Category: Boronic Acids
• Molecular Weight: 201.81
• Molecular Formula: C₅H₅NO₂BBr

Custom Q&A

What is the molecular formula of 3-Bromo-4-pyridineboronic acid?

The molecular formula of 3-Bromo-4-pyridineboronic acid is C5H5BBrNO2.

What is the molecular weight of 3-Bromo-4-pyridineboronic acid?

The molecular weight of 3-Bromo-4-pyridineboronic acid is 201.82 g/mol.

What is the IUPAC name of 3-Bromo-4-pyridineboronic acid?

The IUPAC name of 3-Bromo-4-pyridineboronic acid is (3-bromopyridin-4-yl)boronic acid.

What is the InChI of 3-Bromo-4-pyridineboronic acid?

The InChI of 3-Bromo-4-pyridineboronic acid is InChI=1S/C5H5BBrNO2/c7-5-3-8-2-1-4(5)6(9)10/h1-3,9-10H.

What is the InChIKey of 3-Bromo-4-pyridineboronic acid?

The InChIKey of 3-Bromo-4-pyridineboronic acid is KGJJYDKVEPQIKZ-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromo-4-pyridineboronic acid?

The canonical SMILES of 3-Bromo-4-pyridineboronic acid is B(C1=C(C=NC=C1)Br)(O)O.

What is the CAS number of 3-Bromo-4-pyridineboronic acid?

The CAS number of 3-Bromo-4-pyridineboronic acid is 458532-99-5.

How many hydrogen bond donor counts does 3-Bromo-4-pyridineboronic acid have?

3-Bromo-4-pyridineboronic acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Bromo-4-pyridineboronic acid have?

3-Bromo-4-pyridineboronic acid has 3 hydrogen bond acceptor counts.

What is the topological polar surface area of 3-Bromo-4-pyridineboronic acid?

The topological polar surface area of 3-Bromo-4-pyridineboronic acid is 53.4Ų.