3-Bromo-4-nitrobenzaldehyde

• CAS: 101682-68-2
• Catalog Number: ACM101682682
• Category: Bromine Series
• Molecular Weight: 230.01
• Molecular Formula: C₇H₄BrNO₃

Custom Q&A

What is the molecular formula of 3-bromo-4-nitrobenzaldehyde?

The molecular formula of 3-bromo-4-nitrobenzaldehyde is C7H4BrNO3.

What is the molecular weight of 3-bromo-4-nitrobenzaldehyde?

The molecular weight of 3-bromo-4-nitrobenzaldehyde is 230.02 g/mol.

What is the IUPAC name of 3-bromo-4-nitrobenzaldehyde?

The IUPAC name of 3-bromo-4-nitrobenzaldehyde is 3-bromo-4-nitrobenzaldehyde.

What is the InChI of 3-bromo-4-nitrobenzaldehyde?

The InChI of 3-bromo-4-nitrobenzaldehyde is InChI=1S/C7H4BrNO3/c8-6-3-5(4-10)1-2-7(6)9(11)12/h1-4H.

What is the InChIKey of 3-bromo-4-nitrobenzaldehyde?

The InChIKey of 3-bromo-4-nitrobenzaldehyde is ZVNHPTMSLSAAET-UHFFFAOYSA-N.

What is the canonical SMILES of 3-bromo-4-nitrobenzaldehyde?

The canonical SMILES of 3-bromo-4-nitrobenzaldehyde is C1=CC(=C(C=C1C=O)Br)[N+](=O)[O-].

What is the CAS number of 3-bromo-4-nitrobenzaldehyde?

The CAS number of 3-bromo-4-nitrobenzaldehyde is 101682-68-2.

What is the EC number of 3-bromo-4-nitrobenzaldehyde?

The EC number of 3-bromo-4-nitrobenzaldehyde is not provided in the reference.

What is the XLogP3 value of 3-bromo-4-nitrobenzaldehyde?

The XLogP3 value of 3-bromo-4-nitrobenzaldehyde is 2.

How many hydrogen bond acceptors does 3-bromo-4-nitrobenzaldehyde have?

3-bromo-4-nitrobenzaldehyde has 3 hydrogen bond acceptors.