CAS
130723-13-6 Purity
---
130723-13-6 Purity
---
Inquiry Basket
3-Bromo-4-fluorobenzoyl chloride
CAS
672-75-3
Catalog Number
ACM672753
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-4-fluorobenzoyl chloride?
The molecular formula of 3-Bromo-4-fluorobenzoyl chloride is C7H3BrClFO.
What is the molecular weight of 3-Bromo-4-fluorobenzoyl chloride?
The molecular weight of 3-Bromo-4-fluorobenzoyl chloride is 237.45 g/mol.
What is the IUPAC name of 3-Bromo-4-fluorobenzoyl chloride?
The IUPAC name of 3-Bromo-4-fluorobenzoyl chloride is 3-bromo-4-fluorobenzoyl chloride.
What is the InChI of 3-Bromo-4-fluorobenzoyl chloride?
The InChI of 3-Bromo-4-fluorobenzoyl chloride is InChI=1S/C7H3BrClFO/c8-5-3-4(7(9)11)1-2-6(5)10/h1-3H.
What is the InChIKey of 3-Bromo-4-fluorobenzoyl chloride?
The InChIKey of 3-Bromo-4-fluorobenzoyl chloride is HPHZOCIBMCWXCQ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-4-fluorobenzoyl chloride?
The canonical SMILES of 3-Bromo-4-fluorobenzoyl chloride is C1=CC(=C(C=C1C(=O)Cl)Br)F.
What is the CAS number of 3-Bromo-4-fluorobenzoyl chloride?
The CAS number of 3-Bromo-4-fluorobenzoyl chloride is 672-75-3.
What is the EC number of 3-Bromo-4-fluorobenzoyl chloride?
The EC number of 3-Bromo-4-fluorobenzoyl chloride is 211-596-9.
What is the molecular weight of 3-Bromo-4-fluorobenzoyl chloride in g/mol?
The molecular weight of 3-Bromo-4-fluorobenzoyl chloride is 237.45 g/mol.
Is 3-Bromo-4-fluorobenzoyl chloride a canonicalized compound?
Yes, 3-Bromo-4-fluorobenzoyl chloride is a canonicalized compound according to PubChem.
Recommended Products
