3-Bromo-4-fluorobenzaldehyde dimethyl acetal

• CAS: 81358-65-8
• Catalog Number: ACM81358658
• Category: Bromine Series
• Molecular Weight: 249.08
• Molecular Formula: C9H10BrFO2
• Synonyms: 3-BROMO-4-FLUOROBENZALDEHYDE DIMETHYL ACETAL

Custom Q&A

What is the molecular formula of 3-Bromo-4-fluorobenzaldehyde dimethyl acetal?

The molecular formula is C9H10BrFO2.

What is the molecular weight of 3-Bromo-4-fluorobenzaldehyde dimethyl acetal?

The molecular weight is 249.08 g/mol.

What is the IUPAC name of 3-Bromo-4-fluorobenzaldehyde dimethyl acetal?

The IUPAC name is 2-bromo-4-(dimethoxymethyl)-1-fluorobenzene.

What is the InChI of 3-Bromo-4-fluorobenzaldehyde dimethyl acetal?

The InChI is InChI=1S/C9H10BrFO2/c1-12-9(13-2)6-3-4-8(11)7(10)5-6/h3-5,9H,1-2H3.

What is the InChIKey of 3-Bromo-4-fluorobenzaldehyde dimethyl acetal?

The InChIKey is BYQHKXISZJLWJG-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Bromo-4-fluorobenzaldehyde dimethyl acetal?

The canonical SMILES is COC(C1=CC(=C(C=C1)F)Br)OC.

What is the CAS number of 3-Bromo-4-fluorobenzaldehyde dimethyl acetal?

The CAS number is 81358-65-8.

What is the XLogP3-AA of 3-Bromo-4-fluorobenzaldehyde dimethyl acetal?

The XLogP3-AA is 2.3.

How many hydrogen bond donor counts does 3-Bromo-4-fluorobenzaldehyde dimethyl acetal have?

It doesn't have any hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Bromo-4-fluorobenzaldehyde dimethyl acetal have?

It has three hydrogen bond acceptor counts.