3-Benzyloxy-4-fluorophenylboronic acid

• CAS: 957034-74-1
• Catalog Number: ACM957034741
• Category: Boronic Acids
• Molecular Formula: C₁₃H₁₂BFO₃

Custom Q&A

What is the molecular formula of the compound 3-Benzyloxy-4-fluorophenylboronic acid?

The molecular formula is C13H12BFO3.

When was the compound created according to the reference?

The compound was created on January 26, 2010.

What is the molecular weight of 3-Benzyloxy-4-fluorophenylboronic acid?

The molecular weight is 246.04 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is (4-fluoro-3-phenylmethoxyphenyl)boronic acid.

What is the canonical SMILES of 3-Benzyloxy-4-fluorophenylboronic acid?

The canonical SMILES is B(C1=CC(=C(C=C1)F)OCC2=CC=CC=C2)(O)O.

How many hydrogen bond donor counts are there in the compound?

There are 2 hydrogen bond donor counts.

How many rotatable bond counts are there in the compound?

There are 4 rotatable bond counts.

What is the exact mass of the compound?

The exact mass is 246.0863526 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.

How many hydrogen bond acceptor counts are there in the compound?

There are 4 hydrogen bond acceptor counts.