3-Aminocarborane

• CAS: 22043-65-8
• Catalog Number: ACM22043658
• Category: Other Products
• Molecular Weight: 159.242
• Molecular Formula: C₂H₁₃B₁₀N
• Synonyms: 3-Aminocarborane

Custom Q&A

What is the molecular formula of 3-Aminocarborane?

The molecular formula of 3-Aminocarborane is C2H4B10N.

What is the synonym for 3-Aminocarborane?

The synonym for 3-Aminocarborane is AKOS006278746.

What is the molecular weight of 3-Aminocarborane?

The molecular weight of 3-Aminocarborane is 150.2 g/mol.

What is the InChI of 3-Aminocarborane?

The InChI of 3-Aminocarborane is InChI=1S/C2H4B10N/c13-12-2-1(3-2)4-5-6-7-8-9-10-11-12/h1-2H,13H2.

What is the InChIKey of 3-Aminocarborane?

The InChIKey of 3-Aminocarborane is PTVBGXCISSYRRK-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Aminocarborane?

The canonical SMILES of 3-Aminocarborane is [B]1[B][B][B][B]C2[B]C2B([B][B][B]1)N.

How many hydrogen bond donor counts does 3-Aminocarborane have?

3-Aminocarborane has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 3-Aminocarborane have?

3-Aminocarborane has 1 hydrogen bond acceptor count.

How many rotatable bond counts does 3-Aminocarborane have?

3-Aminocarborane has 0 rotatable bond counts.

What is the topological polar surface area of 3-Aminocarborane?

The topological polar surface area of 3-Aminocarborane is 26.2.