39478-78-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 3-bromo-5-(trifluoromethyl)aniline.
The molecular weight of the compound is 240.02 g/mol.
The InChIKey of the compound is HJTLKVYOWNTDPF-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=C(C=C(C=C1N)Br)C(F)(F)F.
The CAS number of the compound is 54962-75-3.
The EC number of the compound is 259-412-6.
The UNII of the compound is 7LQ4G2QG6G.
The DSSTox Substance ID of the compound is DTXSID80203491.
The XLogP3-AA value of the compound is 2.8.
Yes, the compound is canonicalized according to PubChem.