3-Amino-5-bromo-2-methoxypyridine

• CAS: 884495-39-0
• Catalog Number: ACM884495390
• Category: Bromine Series
• Molecular Formula: C₆H₇BrN₂O

Custom Q&A

What is the molecular formula of 3-Amino-5-bromo-2-methoxypyridine?

The molecular formula of 3-Amino-5-bromo-2-methoxypyridine is C6H7BrN2O.

What is the molecular weight of 3-Amino-5-bromo-2-methoxypyridine?

The molecular weight of 3-Amino-5-bromo-2-methoxypyridine is 203.04 g/mol.

What is the IUPAC name of 3-Amino-5-bromo-2-methoxypyridine?

The IUPAC name of 3-Amino-5-bromo-2-methoxypyridine is 5-bromo-2-methoxypyridin-3-amine.

What is the InChI of 3-Amino-5-bromo-2-methoxypyridine?

The InChI of 3-Amino-5-bromo-2-methoxypyridine is InChI=1S/C6H7BrN2O/c1-10-6-5(8)2-4(7)3-9-6/h2-3H,8H2,1H3.

What is the InChIKey of 3-Amino-5-bromo-2-methoxypyridine?

The InChIKey of 3-Amino-5-bromo-2-methoxypyridine is HJOOFLFWIISCAI-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Amino-5-bromo-2-methoxypyridine?

The canonical SMILES of 3-Amino-5-bromo-2-methoxypyridine is COC1=C(C=C(C=N1)Br)N.

What is the CAS number of 3-Amino-5-bromo-2-methoxypyridine?

The CAS number of 3-Amino-5-bromo-2-methoxypyridine is 884495-39-0.

What is the XLogP3-AA value of 3-Amino-5-bromo-2-methoxypyridine?

The XLogP3-AA value of 3-Amino-5-bromo-2-methoxypyridine is 1.2.

Is 3-Amino-5-bromo-2-methoxypyridine a canonicalized compound?

Yes, 3-Amino-5-bromo-2-methoxypyridine is a canonicalized compound according to PubChem.