3-Amino-3-(4-chlorophenyl)cyclobutanol

• Catalog Number: ACMA00000784
• Category: Amines
• Molecular Weight: 197.66
• Molecular Formula: C₁₀H₉NO₃S
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-Amino-3-(4-chlorophenyl)cyclobutanol?

The molecular formula of 3-Amino-3-(4-chlorophenyl)cyclobutanol is C10H12ClNO.

What is the molecular weight of 3-Amino-3-(4-chlorophenyl)cyclobutanol?

The molecular weight of 3-Amino-3-(4-chlorophenyl)cyclobutanol is 197.66 g/mol.

What is the IUPAC name of 3-Amino-3-(4-chlorophenyl)cyclobutanol?

The IUPAC name of 3-Amino-3-(4-chlorophenyl)cyclobutanol is 3-amino-3-(4-chlorophenyl)cyclobutan-1-ol.

What is the InChI of 3-Amino-3-(4-chlorophenyl)cyclobutanol?

The InChI of 3-Amino-3-(4-chlorophenyl)cyclobutanol is InChI=1S/C10H12ClNO/c11-8-3-1-7(2-4-8)10(12)5-9(13)6-10/h1-4,9,13H,5-6,12H2.

What is the InChIKey of 3-Amino-3-(4-chlorophenyl)cyclobutanol?

The InChIKey of 3-Amino-3-(4-chlorophenyl)cyclobutanol is GXYJVPQFSRJBFI-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Amino-3-(4-chlorophenyl)cyclobutanol?

The canonical SMILES of 3-Amino-3-(4-chlorophenyl)cyclobutanol is C1C(CC1(C2=CC=C(C=C2)Cl)N)O.

What is the XLogP3-AA value of 3-Amino-3-(4-chlorophenyl)cyclobutanol?

The XLogP3-AA value of 3-Amino-3-(4-chlorophenyl)cyclobutanol is 1.1.

How many hydrogen bond donor counts does 3-Amino-3-(4-chlorophenyl)cyclobutanol have?

3-Amino-3-(4-chlorophenyl)cyclobutanol has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Amino-3-(4-chlorophenyl)cyclobutanol have?

3-Amino-3-(4-chlorophenyl)cyclobutanol has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does 3-Amino-3-(4-chlorophenyl)cyclobutanol have?

3-Amino-3-(4-chlorophenyl)cyclobutanol has 1 rotatable bond count.