CAS
--- Purity
---
--- Purity
---
Inquiry Basket
(3-Amino-1-methylpropyl)ethyl(methyl)amine
Catalog Number
ACMA00001424
Category
Amines
Molecular Weight
130.23
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H226-H314
RIDADR
NONH for all modes of transport
Symbol
GHS02
What is the PubChem CID of the compound?
The PubChem CID of the compound is 25219172.
What is the molecular formula of the compound?
The molecular formula of the compound is C7H18N2.
What are the synonyms of the compound?
The synonyms of the compound are N-(3-amino-1-methylpropyl)-N-ethyl-N-methylamine, 1033693-03-6, N3-Ethyl-N3-methylbutane-1,3-diamine, and (3-amino-1-methylpropyl)ethyl(methyl)amine.
What is the molecular weight of the compound?
The molecular weight of the compound is 130.23 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-N-ethyl-3-N-methylbutane-1,3-diamine.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H18N2/c1-4-9(3)7(2)5-6-8/h7H,4-6,8H2,1-3H3.
What is the InChIKey of the compound?
The InChIKey of the compound is UVQPZTDUOSENTP-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCN(C)C(C)CCN.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 0.5.
How many hydrogen bond donor and acceptor counts does the compound have?
The compound has 1 hydrogen bond donor count and 2 hydrogen bond acceptor counts.
Recommended Products
