[3-(prop-2-enylcarbamoyl)phenyl]boronic acid

• CAS: 850567-29-2
• Catalog Number: ACM850567292
• Category: Main Products
• Molecular Weight: 205.02
• Molecular Formula: C10H12BNO3
• Synonyms: (3-(Allylcarbamoyl)Phenyl)Boronic Acid
• Appearance: Liquid

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H12BNO3.

What are the synonyms of the compound?

The synonyms of the compound are 850567-29-2, 3-Allylaminocarbonylphenylboronic acid, (3-(Allylcarbamoyl)phenyl)boronic acid, [3-(prop-2-enylcarbamoyl)phenyl]boronic Acid, and (3-Allylaminocarbonyl)phenylboronic acid.

What is the molecular weight of the compound?

The molecular weight of the compound is 205.02 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is [3-(prop-2-enylcarbamoyl)phenyl]boronic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H12BNO3/c1-2-6-12-10(13)8-4-3-5-9(7-8)11(14)15/h2-5,7,14-15H,1,6H2,(H,12,13).

What is the InChIKey of the compound?

The InChIKey of the compound is BGDGMVTUXWBLLR-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is B(C1=CC(=CC=C1)C(=O)NCC=C)(O)O.

What is the CAS number of the compound?

The CAS number of the compound is 850567-29-2.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 3.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 3.