3-Acetyl-6-bromo-2-fluorophenylboronic acid

• CAS: 1451390-80-9
• Catalog Number: ACM1451390809
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 3-Acetyl-6-bromo-2-fluorophenylboronic acid?

The molecular formula is C8H7BBrFO3.

When was 3-Acetyl-6-bromo-2-fluorophenylboronic acid first created and modified?

It was first created on 2012-08-08 and modified on 2023-12-02.

What is the IUPAC name of 3-Acetyl-6-bromo-2-fluorophenylboronic acid?

The IUPAC name is (3-acetyl-6-bromo-2-fluorophenyl)boronic acid.

What is the InChI of 3-Acetyl-6-bromo-2-fluorophenylboronic acid?

The InChI is InChI=1S/C8H7BBrFO3/c1-4(12)5-2-3-6(10)7(8(5)11)9(13)14/h2-3,13-14H,1H3.

How many hydrogen bond donor counts does 3-Acetyl-6-bromo-2-fluorophenylboronic acid have?

It has 2 hydrogen bond donor counts.

What is the exact mass of 3-Acetyl-6-bromo-2-fluorophenylboronic acid?

The exact mass is 259.96556 g/mol.

How many heavy atoms are present in 3-Acetyl-6-bromo-2-fluorophenylboronic acid?

There are 14 heavy atoms.

Does 3-Acetyl-6-bromo-2-fluorophenylboronic acid have any defined bond stereocenter counts?

No, it does not have any defined bond stereocenter counts.

What is the topological polar surface area of 3-Acetyl-6-bromo-2-fluorophenylboronic acid?

The topological polar surface area is 57.5Ų.

Is 3-Acetyl-6-bromo-2-fluorophenylboronic acid a canonicalized compound?

Yes, it is a canonicalized compound.