CAS
1218790-95-4 Purity
---
1218790-95-4 Purity
---
Inquiry Basket
3,5-Difluoropyridine-4-boronicacid
CAS
956003-87-5
Catalog Number
ACM956003875-1
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,5-Difluoropyridine-4-boronicacid?
The molecular formula is C5H4BF2NO2.
What is the molecular weight of 3,5-Difluoropyridine-4-boronicacid?
The molecular weight is 158.90 g/mol.
When was 3,5-Difluoropyridine-4-boronicacid created?
It was created on September 7, 2005.
What is the IUPAC name of 3,5-Difluoropyridine-4-boronicacid?
The IUPAC name is (3,5-difluoropyridin-4-yl)boronic acid.
What is the InChI of 3,5-Difluoropyridine-4-boronicacid?
The InChI is InChI=1S/C5H4BF2NO2/c7-3-1-9-2-4(8)5(3)6(10)11/h1-2,10-11H.
What is the Canonical SMILES of 3,5-Difluoropyridine-4-boronicacid?
The Canonical SMILES is B(C1=C(C=NC=C1F)F)(O)O.
What is the CAS number of 3,5-Difluoropyridine-4-boronicacid?
The CAS number is 956003-87-5.
How many hydrogen bond donor count does 3,5-Difluoropyridine-4-boronicacid have?
It has 2 hydrogen bond donor count.
How many hydrogen bond acceptor count does 3,5-Difluoropyridine-4-boronicacid have?
It has 5 hydrogen bond acceptor count.
What is the topological polar surface area of 3,5-Difluoropyridine-4-boronicacid?
The topological polar surface area is 53.4Ų.
Recommended Products
