CAS
63837-11-6 Purity
96%
63837-11-6 Purity
96%
Inquiry Basket
3,5-Dibromo-2-aminobenzonitrile
CAS
68385-95-5
Catalog Number
ACM68385955
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,5-Dibromo-2-aminobenzonitrile?
The molecular formula of 3,5-Dibromo-2-aminobenzonitrile is C7H4Br2N2.
What is the molecular weight of 3,5-Dibromo-2-aminobenzonitrile?
The molecular weight of 3,5-Dibromo-2-aminobenzonitrile is 275.93 g/mol.
What is the IUPAC name of 3,5-Dibromo-2-aminobenzonitrile?
The IUPAC name of 3,5-Dibromo-2-aminobenzonitrile is 2-amino-3,5-dibromobenzonitrile.
What is the InChIKey of 3,5-Dibromo-2-aminobenzonitrile?
The InChIKey of 3,5-Dibromo-2-aminobenzonitrile is WLZCMGXAEXFAQA-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 3,5-Dibromo-2-aminobenzonitrile?
The Canonical SMILES representation of 3,5-Dibromo-2-aminobenzonitrile is C1=C(C=C(C(=C1C#N)N)Br)Br.
What is the XLogP3-AA value of 3,5-Dibromo-2-aminobenzonitrile?
The XLogP3-AA value of 3,5-Dibromo-2-aminobenzonitrile is 2.9.
How many hydrogen bond donor counts are present in 3,5-Dibromo-2-aminobenzonitrile?
There is 1 hydrogen bond donor count present in 3,5-Dibromo-2-aminobenzonitrile.
What is the topological polar surface area of 3,5-Dibromo-2-aminobenzonitrile?
The topological polar surface area of 3,5-Dibromo-2-aminobenzonitrile is 49.8Ų.
How many heavy atoms are there in the structure of 3,5-Dibromo-2-aminobenzonitrile?
There are 11 heavy atoms in the structure of 3,5-Dibromo-2-aminobenzonitrile.
Is 3,5-Dibromo-2-aminobenzonitrile considered canonicalized according to PubChem?
Yes, 3,5-Dibromo-2-aminobenzonitrile is considered canonicalized according to PubChem.
Recommended Products
