--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C16H18FNO.
The molecular weight of the compound is 259.32 g/mol.
The IUPAC name of the compound is 3-(4-fluorophenyl)-3-(4-methoxyphenyl)propan-1-amine.
The InChI of the compound is InChI=1S/C16H18FNO/c1-19-15-8-4-13(5-9-15)16(10-11-18)12-2-6-14(17)7-3-12/h2-9,16H,10-11,18H2,1H3.
The InChIKey of the compound is IYOIETVLDHFHQD-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=CC=C(C=C1)C(CCN)C2=CC=C(C=C2)F.
The XLogP3 value of the compound is 3.5.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor count.
The compound has 5 rotatable bond count.