(3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide

• Catalog Number: ACMA00000938
• Category: Amines
• Molecular Weight: 205.26
• Molecular Formula: C₁₁H₁₅NO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

The molecular formula is C11H15N3O.

What is the molecular weight of (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

The molecular weight is 205.26 g/mol.

What is the IUPAC name of (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

The IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)acetohydrazide.

What is the InChI of (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

The InChI is InChI=1S/C11H15N3O/c12-13-11(15)8-14-7-3-5-9-4-1-2-6-10(9)14/h1-2,4,6H,3,5,7-8,12H2,(H,13,15).

What is the InChIKey of (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

The InChIKey is QHIRAJVXKFEPFS-UHFFFAOYSA-N.

What is the canonical SMILES of (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

The canonical SMILES is C1CC2=CC=CC=C2N(C1)CC(=O)NN.

What is the XLogP3-AA value of (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

The XLogP3-AA value is 1.

How many hydrogen bond donor counts are there in (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

There are 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts are there in (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

There are 3 hydrogen bond acceptor counts.

How many rotatable bond counts are there in (3,4-Dihydro-2H-quinolin-1-yl)-acetic acid hydrazide?

There are 2 rotatable bond counts.