3,4-Dichloro-N-methylaniline

• CAS: 40750-59-2
• Catalog Number: ACM40750592
• Category: Amines
• Molecular Weight: 176.04
• Molecular Formula: C₇H₇Cl₂N
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3,4-Dichloro-N-methylaniline?

The molecular formula is C7H7Cl2N.

What is the molecular weight of 3,4-Dichloro-N-methylaniline?

The molecular weight is 176.04 g/mol.

What is the IUPAC name of 3,4-Dichloro-N-methylaniline?

The IUPAC name is 3,4-dichloro-N-methylaniline.

What is the InChI of 3,4-Dichloro-N-methylaniline?

The InChI is InChI=1S/C7H7Cl2N/c1-10-5-2-3-6(8)7(9)4-5/h2-4,10H,1H3.

What is the InChIKey of 3,4-Dichloro-N-methylaniline?

The InChIKey is DUSNCFKVMGTTFK-UHFFFAOYSA-N.

What is the Canonical SMILES of 3,4-Dichloro-N-methylaniline?

The Canonical SMILES is CNC1=CC(=C(C=C1)Cl)Cl.

What is the CAS number of 3,4-Dichloro-N-methylaniline?

The CAS number is 40750-59-2.

What is the XLogP3 value of 3,4-Dichloro-N-methylaniline?

The XLogP3 value is 3.4.

How many hydrogen bond donor counts does 3,4-Dichloro-N-methylaniline have?

It has 1 hydrogen bond donor count.

How many rotatable bond counts does 3,4-Dichloro-N-methylaniline have?

It has 1 rotatable bond count.