3-(4-Bromophenyl)-5-methyl-1,2,4-oxadiazole

• CAS: 118183-92-9
• Catalog Number: ACM118183929
• Category: Other
• Molecular Weight: 239.07
• Molecular Formula: C9H7BrN2O

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H7BrN2O.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-(4-bromophenyl)-5-methyl-1,2,4-oxadiazole.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H7BrN2O/c1-6-11-9(12-13-6)7-2-4-8(10)5-3-7/h2-5H,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is YWBIOYGLRGIJRT-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number of the compound is 118183-92-9.

What is the molecular weight of the compound?

The molecular weight of the compound is 239.07 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 1 rotatable bond count.

Is the compound canonicalized?

Yes, the compound is canonicalized.