CAS
811713-09-4 Purity
---
811713-09-4 Purity
---
Inquiry Basket
3-(4-Bromophenyl)-1H-pyrazole
CAS
73387-46-9
Catalog Number
ACM73387469
Category
Bromine Series
Molecular Weight
223.07
Molecular Formula
C9H7BrN2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C9H7BrN2.
What is the molecular weight of the compound?
The molecular weight of the compound is 223.07 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-(4-bromophenyl)-1H-pyrazole.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H7BrN2/c10-8-3-1-7(2-4-8)9-5-6-11-12-9/h1-6H,(H,11,12).
What is the InChIKey of the compound?
The InChIKey of the compound is LXDGTEBHVOKDLE-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC=C1C2=CC=NN2)Br.
What is the CAS number of the compound?
The CAS number of the compound is 73387-46-9.
What is the EC number of the compound?
The EC number of the compound is 627-370-1.
What is the monoisotopic mass of the compound?
The monoisotopic mass of the compound is 221.97926 g/mol.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.
Recommended Products
