455-38-9 Purity
N/A
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3-(3-Fluorophenyl)propionic acid is C9H9FO2.
The molecular weight of 3-(3-Fluorophenyl)propionic acid is 168.16 g/mol.
The IUPAC name of 3-(3-Fluorophenyl)propionic acid is 3-(3-fluorophenyl)propanoic acid.
The InChI of 3-(3-Fluorophenyl)propionic acid is InChI=1S/C9H9FO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5H2,(H,11,12).
The InChIKey of 3-(3-Fluorophenyl)propionic acid is UBLMRADOKLXLCD-UHFFFAOYSA-N.
3-(3-Fluorophenyl)propionic acid has 1 hydrogen bond donor count.
The topological polar surface area of 3-(3-Fluorophenyl)propionic acid is 37.3 Å2.
3-(3-Fluorophenyl)propionic acid has 3 rotatable bond counts.
Yes, 3-(3-Fluorophenyl)propionic acid is considered as a canonicalized compound.
The formal charge of 3-(3-Fluorophenyl)propionic acid is 0.