CAS
418762-26-2 Purity
98%
418762-26-2 Purity
98%
Inquiry Basket
3-(3-Bromophenyl)propionic acid
CAS
42287-90-1
Catalog Number
ACM42287901
Category
Bromine Series
Molecular Weight
229.07
Molecular Formula
C9H9O2Br
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-(3-Bromophenyl)propionic acid?
The molecular formula of 3-(3-Bromophenyl)propionic acid is C9H9BrO2.
What is the molecular weight of 3-(3-Bromophenyl)propionic acid?
The molecular weight of 3-(3-Bromophenyl)propionic acid is 229.07 g/mol.
What is the IUPAC name of 3-(3-Bromophenyl)propionic acid?
The IUPAC name of 3-(3-Bromophenyl)propionic acid is 3-(3-bromophenyl)propanoic acid.
What is the InChI of 3-(3-Bromophenyl)propionic acid?
The InChI of 3-(3-Bromophenyl)propionic acid is InChI=1S/C9H9BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5H2,(H,11,12).
What is the InChIKey of 3-(3-Bromophenyl)propionic acid?
The InChIKey of 3-(3-Bromophenyl)propionic acid is DWKWMFSWLCIMKI-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-(3-Bromophenyl)propionic acid?
The Canonical SMILES of 3-(3-Bromophenyl)propionic acid is C1=CC(=CC(=C1)Br)CCC(=O)O.
What is the CAS number of 3-(3-Bromophenyl)propionic acid?
The CAS number of 3-(3-Bromophenyl)propionic acid is 42287-90-1.
What is the XLogP3-AA value of 3-(3-Bromophenyl)propionic acid?
The XLogP3-AA value of 3-(3-Bromophenyl)propionic acid is 2.4.
How many hydrogen bond donor counts does 3-(3-Bromophenyl)propionic acid have?
3-(3-Bromophenyl)propionic acid has 1 hydrogen bond donor count.
How many rotatable bond counts does 3-(3-Bromophenyl)propionic acid have?
3-(3-Bromophenyl)propionic acid has 3 rotatable bond counts.
Recommended Products
