3,3,5-Tribromo-1H-pyrrolo[2,3-b]pyridin-2(3H)-one

• CAS: 183208-32-4
• Catalog Number: ACM183208324
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 3,3,5-Tribromo-1H-pyrrolo[2,3-b]pyridin-2(3H)-one?

The molecular formula is C7H3Br3N2O.

When was the structure of 3,3,5-Tribromo-1H-pyrrolo[2,3-b]pyridin-2(3H)-one created?

The structure was created on 2007-12-05.

What is the IUPAC name of the compound?

The IUPAC name is 3,3,5-tribromo-1H-pyrrolo[2,3-b]pyridin-2-one.

What is the Canonical SMILES of the compound?

The Canonical SMILES is C1=C(C=NC2=C1C(C(=O)N2)(Br)Br)Br.

What is the molecular weight of 3,3,5-Tribromo-1H-pyrrolo[2,3-b]pyridin-2(3H)-one?

The molecular weight is 370.82 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

What is the topological polar surface area of the compound?

The topological polar surface area is 42 Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 2.3.

How many heavy atoms does the compound contain?

The compound contains 13 heavy atoms.